Organonitrogen Compounds
eMolecules 4431-83-8 | Bis(2-methoxyethoxy)methane | Oakwood Chemical | MFCD00043945 | 164.201 | C7H16O4 | 97.000 | COCCOCOCCOC | 5g | 851146928
Bis(2-methoxyethoxy)methane | Oakwood Chemical | 4431-83-8 | MFCD00043945 | 164.201 | C7H16O4 | 97.000 | COCCOCOCCOC | 5g | 851146928
![eMolecules 1965314-73-1 | (S)-ISOINDOLINE-1-CARBOXYLIC ACID HCL | AstaTech | MFCD28098115 | 199.630 | C9H10ClNO2 | 95.000 | Cl.OC(=O)[C@H]1NCc2ccccc12 | 1g | 448262759](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502181579.JPG-250.jpg)
eMolecules 1965314-73-1 | (S)-ISOINDOLINE-1-CARBOXYLIC ACID HCL | AstaTech | MFCD28098115 | 199.630 | C9H10ClNO2 | 95.000 | Cl.OC(=O)[C@H]1NCc2ccccc12 | 1g | 448262759
(S)-ISOINDOLINE-1-CARBOXYLIC ACID HCL | AstaTech | 1965314-73-1 | MFCD28098115 | 199.630 | C9H10ClNO2 | 95.000 | Cl.OC(=O)[C@H]1NCc2ccccc12 | 1g | 448262759
Medchemexpress LLC PEG-bis-amine MW 80 1g
PEG-bis-amine (MW 8000) synthesizes folate-conjugated polymeric micelles for encapsulation of the anticancer agent 9-nitrocamptothecin HY-16560 (HY-16560) Folic acid-conjugated polymer micelles are effective carriers of insoluble anticancer drugs which can avoid macrophages and play a role in endocytosis of tumor cells mediated by folate receptors (FR)
eMolecules 159635-50-4 | tert-Butyl bis(2-bromoethyl)carbamate | Ambeed | MFCD11519276 | 331.048 | C9H17Br2NO2 | 98.000 | CC(C)(C)OC(=O)N(CCBr)CCBr | 10g | 866364695
tert-Butyl bis(2-bromoethyl)carbamate | Ambeed | 159635-50-4 | MFCD11519276 | 331.048 | C9H17Br2NO2 | 98.000 | CC(C)(C)OC(=O)N(CCBr)CCBr | 10g | 866364695
eMolecules 166330-10-5 | Bis(2-diphenylphosphinophenyl)ether | Accela ChemBio (ASD) | MFCD00233863 | 538.567 | C36H28OP2 | 97.000 | O(c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 | 25g | 455888809
Bis(2-diphenylphosphinophenyl)ether | Accela ChemBio (ASD) | 166330-10-5 | MFCD00233863 | 538.567 | C36H28OP2 | 97.000 | O(c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 | 25g | 455888809
eMolecules 166330-10-5 | Bis(2-diphenylphosphinophenyl)ether | Combi-Blocks | MFCD00233863 | 538.567 | C36H28OP2 | 98.000 | O(c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 | 5g | 232332877
Bis(2-diphenylphosphinophenyl)ether | Combi-Blocks | 166330-10-5 | MFCD00233863 | 538.567 | C36H28OP2 | 98.000 | O(c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 | 5g | 232332877
eMolecules 19532-73-1 | N,N'-bis(2-hydroxyphenyl)ethanediamide | AA Blocks LLC | MFCD01534208 | 272.260 | C14H12N2O4 | 0.000 | Oc1ccccc1NC(=O)C(=O)Nc1ccccc1O | 250mg | 437067892
N,N'-bis(2-hydroxyphenyl)ethanediamide | AA Blocks LLC | 19532-73-1 | MFCD01534208 | 272.260 | C14H12N2O4 | 0.000 | Oc1ccccc1NC(=O)C(=O)Nc1ccccc1O | 250mg | 437067892
Selleck Chemical LLC 1-Methylpyrrolidine
1-Methylpyrrolidine is extensively used in the synthesis of pyrrolidine based ionic liquids
Chem-Impex International, Inc. Dimethylamine hydrochloride | Store at RT | 250G
Dimethylamine hydrochloride, Store at RT, 250G
eMolecules 68641-49-6 | N,N-Bis(2-oxo-3-oxazolidinyl)phosphinic chloride | Chem-Impex | MFCD00010077 | 254.560 | C6H8ClN2O5P | 98.000 | ClP(=O)(N1CCOC1=O)N1CCOC1=O | 100g | 112443008
N,N-Bis(2-oxo-3-oxazolidinyl)phosphinic chloride | Chem-Impex | 68641-49-6 | MFCD00010077 | 254.560 | C6H8ClN2O5P | 98.000 | ClP(=O)(N1CCOC1=O)N1CCOC1=O | 100g | 112443008